60484-67-5 Usage
Uses
Used in Chemical Synthesis:
4-N-Heptylbenzonitrile is used as a synthetic intermediate for the production of various chemical substances and materials. Its role in the synthesis process is crucial, as it can be transformed into a range of different compounds with diverse applications across various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 4-N-Heptylbenzonitrile is utilized as a building block in the development of new drugs. Its unique chemical structure allows for the creation of potential therapeutic agents that can address specific medical needs.
Used in Material Science:
4-N-Heptylbenzonitrile is employed in the field of material science to create novel materials with tailored properties. Its integration into the composition of these materials can lead to advancements in areas such as electronics, plastics, and coatings.
Used in Research and Development:
4-N-Heptylbenzonitrile is also used as a research compound in academic and industrial laboratories. Its properties and reactivity are studied to gain insights into the behavior of benzonitrile compounds and to explore potential new applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 60484-67-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,4,8 and 4 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 60484-67:
(7*6)+(6*0)+(5*4)+(4*8)+(3*4)+(2*6)+(1*7)=125
125 % 10 = 5
So 60484-67-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H19N/c1-2-3-4-5-6-7-13-8-10-14(12-15)11-9-13/h8-11H,2-7H2,1H3
60484-67-5Relevant articles and documents
Negishi alkyl-aryl cross-coupling catalyzed by Rh: Efficiency of novel tripodal 3-diphenylphosphino-2-(diphenylphosphino)methyl-2-methylpropyl acetate ligand
Ejiri, Syogo,Odo, Shunsuke,Takahashi, Hideki,Nishimura, Yugo,Gotoh, Kazuma,Nishihara, Yasushi,Takagi, Kentaro
supporting information; experimental part, p. 1692 - 1695 (2010/09/03)
3-Diphenylphosphino-2-(diphenylphoshino)methyl-2-methylpropyl acetate acted as an efficient ligand for a Rh catalyst, achieving cross-coupling between arylzinc compounds bearing electron-withdrawing groups and alkyl electrophiles. The beneficial effect of the tripodal ligand and such aryl nucleophiles was discussed with regard to the specificity of the Rh catalysis.
