60487-81-2 Usage
General Description
[Bis[(3-phenylallyl)oxy]methyl]vinylbenzene is a complex chemical compound consisting of multiple functional groups. It contains two molecules of the allyl group (3-phenylallyl)oxy attached to a central methylene bridge, which in turn is connected to a vinylbenzene group. The presence of allyl and vinyl groups suggests that this compound may have potential applications in polymerization or crosslinking reactions. Additionally, the presence of the benzene ring indicates that this compound may exhibit aromatic properties. The specific properties and potential uses of bis[(3-phenylallyl)oxy]methyl]vinylbenzene would depend on its reactivity, stability, and other chemical characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 60487-81-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,4,8 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 60487-81:
(7*6)+(6*0)+(5*4)+(4*8)+(3*7)+(2*8)+(1*1)=132
132 % 10 = 2
So 60487-81-2 is a valid CAS Registry Number.
InChI:InChI=1/C27H26O2/c1-23(26-19-9-4-10-20-26)27(28-21-11-17-24-13-5-2-6-14-24)29-22-12-18-25-15-7-3-8-16-25/h2-20,27H,1,21-22H2