60492-61-7 Usage
General Description
1,4-Dihydro-3,6-diphenyl-pyrazolo[4,3-c]pyrazole is a chemical compound with the molecular formula C18H16N4. It is a heterocyclic compound containing two pyrazole rings fused together, and it is commonly used in organic synthesis and medicinal chemistry. 1,4-DIHYDRO-3,6-DIPHENYL-PYRAZOLO[4,3-C]PYRAZOLE has been studied for its potential pharmacological activities, including its potential as a drug candidate for various medical conditions. Its unique structural features make it a valuable building block for the synthesis of novel chemical compounds with potential therapeutic applications. The compound's properties and potential uses continue to be the subject of ongoing research in the field of chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 60492-61-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,4,9 and 2 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 60492-61:
(7*6)+(6*0)+(5*4)+(4*9)+(3*2)+(2*6)+(1*1)=117
117 % 10 = 7
So 60492-61-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H12N4/c1-3-7-11(8-4-1)13-15-16(20-17-13)14(18-19-15)12-9-5-2-6-10-12/h1-10H,(H,17,20)(H,18,19)
