60548-45-0 Usage
Uses
Used in Organic Synthesis:
(Z)-4-Bromo-N-cyclopropyl-α,β-dimethylcinnamamide is used as a key intermediate in the synthesis of various organic compounds. Its unique structure and reactivity make it a valuable building block for creating complex molecules with specific properties and applications.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (Z)-4-Bromo-N-cyclopropyl-α,β-dimethylcinnamamide is utilized as a starting material or a component in the development of new drugs. Its structural features may contribute to the design of innovative therapeutic agents targeting a range of medical conditions.
Used in Chemical Compound Development:
(Z)-4-Bromo-N-cyclopropyl-α,β-dimethylcinnamamide is also employed in the creation of new chemical compounds with potential applications in various industries, such as materials science, agrochemicals, and environmental science. Its versatility in chemical reactions allows for the exploration of new compound classes with improved or novel functionalities.
Check Digit Verification of cas no
The CAS Registry Mumber 60548-45-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,5,4 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 60548-45:
(7*6)+(6*0)+(5*5)+(4*4)+(3*8)+(2*4)+(1*5)=120
120 % 10 = 0
So 60548-45-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H16BrNO/c1-9(11-3-5-12(15)6-4-11)10(2)14(17)16-13-7-8-13/h3-6,13H,7-8H2,1-2H3,(H,16,17)/b10-9-
