60548-50-7

Usage

Uses

Used in Organic Synthesis:
(Z)-N-Allyl-4-bromo-α,β-dimethylcinnamamide is utilized as a synthetic building block in the creation of more complex organic molecules. Its unique structural features, including the allyl and bromine substituents, facilitate its use in a range of chemical reactions, making it a versatile component in the synthesis of pharmaceuticals and other specialty chemicals.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (Z)-N-Allyl-4-bromo-α,β-dimethylcinnamamide is employed as a key intermediate for the development of new pharmaceuticals. Its structural diversity and potential for functional group manipulation allow researchers to explore its properties and reactivity, which may lead to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used in Chemical Reaction Studies:
(Z)-N-Allyl-4-bromo-α,β-dimethylcinnamamide serves as an important tool in the study of organic chemical reactions. Its distinct functional groups and reactivity make it an ideal candidate for investigating reaction mechanisms, understanding structure-activity relationships, and optimizing reaction conditions to achieve desired outcomes in chemical synthesis.
Used in Pharmaceutical Development:
(Z)-N-Allyl-4-bromo-α,β-dimethylcinnamamide may have potential applications in the pharmaceutical industry, where it could be used as a starting material or a structural component in the design and synthesis of new drugs. Its unique properties and reactivity could contribute to the development of innovative therapeutic agents with novel mechanisms of action and improved pharmacological profiles.

InChI:InChI=1/C14H16BrNO/c1-4-9-16-14(17)11(3)10(2)12-5-7-13(15)8-6-12/h4-8H,1,9H2,2-3H3,(H,16,17)/b11-10-