606493-11-2 Usage
Uses
3-(4-chlorophenyl)-2-methoxypropanoic acid is used as a chemical intermediate in the synthesis of various organic compounds. The presence of the chlorophenyl, methoxy, and carboxylic acid groups allows it to be a versatile building block in the preparation of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
3-(4-chlorophenyl)-2-methoxypropanoic acid is used as a key intermediate for the synthesis of drugs, where its functional groups can be further modified to create active pharmaceutical ingredients. The chlorophenyl group can be involved in various biological interactions, while the methoxy and carboxylic acid groups can contribute to the drug's solubility, stability, and overall pharmacokinetic properties.
Used in Agrochemical Industry:
3-(4-chlorophenyl)-2-methoxypropanoic acid is used as a precursor in the development of agrochemicals, such as pesticides and herbicides. Its structural features can be exploited to design molecules with specific modes of action, targeting pests or weeds while minimizing harm to non-target organisms and the environment.
Used in Specialty Chemicals:
3-(4-chlorophenyl)-2-methoxypropanoic acid is used as a building block in the production of specialty chemicals, such as dyes, fragrances, and polymers. Its functional groups can be incorporated into larger molecules to impart desired properties, such as color, odor, or physical characteristics, to the final product.
Check Digit Verification of cas no
The CAS Registry Mumber 606493-11-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,0,6,4,9 and 3 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 606493-11:
(8*6)+(7*0)+(6*6)+(5*4)+(4*9)+(3*3)+(2*1)+(1*1)=152
152 % 10 = 2
So 606493-11-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H11ClO3/c1-14-9(10(12)13)6-7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3,(H,12,13)
