60676-83-7 Usage
General Description
4-amino-3,5-dichloro-N-cyclopropyl-benzamide is a synthetic chemical compound that contains a benzamide structure with an amino group and two chlorine atoms attached to the benzene ring. The cyclopropyl group is also attached to the benzamide, providing further structural complexity. 4-amino-3,5-dichloro-N-cyclopropyl-benzamide has potential applications in pharmaceutical research due to its unique structure and potential interactions with biological systems. It may have an impact on the central nervous system or other physiological processes, making it a potential candidate for drug development or other medical applications. Further research is needed to fully understand the properties and potential uses of 4-amino-3,5-dichloro-N-cyclopropyl-benzamide.
Check Digit Verification of cas no
The CAS Registry Mumber 60676-83-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,6,7 and 6 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 60676-83:
(7*6)+(6*0)+(5*6)+(4*7)+(3*6)+(2*8)+(1*3)=137
137 % 10 = 7
So 60676-83-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H10Cl2N2O/c11-7-3-5(4-8(12)9(7)13)10(15)14-6-1-2-6/h3-4,6H,1-2,13H2,(H,14,15)
