60737-54-4 Usage
Chemical structure
The compound consists of a pyrrolidine ring with a cyclopropylmethyl group and a nitromethylene group attached to it.
Cyclopropylmethyl group
A four-membered ring containing three carbon atoms.
Nitromethylene group
Contains a nitro group (NO2) attached to a carbon bonded to the pyrrolidine ring.
Potential applications
Medicinal chemistry and chemical synthesis.
Unique structure
May confer specific biological or chemical properties.
Building block
Useful in the development of new compounds.
Reactivity
Due to its complex structure and potentially reactive nature, it would require careful handling.
Further investigation
Needed to understand its full range of potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 60737-54-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,7,3 and 7 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 60737-54:
(7*6)+(6*0)+(5*7)+(4*3)+(3*7)+(2*5)+(1*4)=124
124 % 10 = 4
So 60737-54-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2O2/c12-11(13)7-9-2-1-5-10(9)6-8-3-4-8/h7-8H,1-6H2
