60772-68-1 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-2,5-dimethylbenzoic acid is used as an intermediate in the synthesis of pharmaceuticals for its versatile reactivity and potential biological activity. It plays a crucial role in the development of new drugs and contributes to the advancement of medicinal chemistry research.
Used in Dye Industry:
In the dye industry, 3-Amino-2,5-dimethylbenzoic acid is used as a key component in the production of various dyes. Its unique chemical structure allows for the creation of a wide range of colors and properties, making it an essential ingredient in the formulation of different types of dyes.
Used in Organic Compounds Synthesis:
3-Amino-2,5-dimethylbenzoic acid is used as an intermediate in the synthesis of various organic compounds and materials. Its reactivity and structural properties make it a valuable building block for the development of new materials with diverse applications in both the pharmaceutical and industrial sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 60772-68-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,7,7 and 2 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 60772-68:
(7*6)+(6*0)+(5*7)+(4*7)+(3*2)+(2*6)+(1*8)=131
131 % 10 = 1
So 60772-68-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO2/c1-5-3-7(9(11)12)6(2)8(10)4-5/h3-4H,10H2,1-2H3,(H,11,12)
60772-68-1Relevant academic research and scientific papers
Anti-inflammatory oxazole[4,5-b]pyridines
-
, (2008/06/13)
The various isomers of oxazolo- and thiazolopyridines having utility as antiinflammatory, antipyretic and analgesic agents are prepared by condensation of an appropriate amino-hydroxypyridine or amino-mercaptopyridine with a carboxylic acid, halide or anhydride.
