60792-56-5 Usage
Uses
Used in Pharmaceutical Synthesis:
1H-Benzimidazole-2-acetamide is used as an intermediate in the synthesis of pharmaceuticals for its antimicrobial and anti-inflammatory properties. It is valued for its potential in treating various medical conditions due to these properties.
Used in Agrochemical Synthesis:
In the agrochemical industry, 1H-Benzimidazole-2-acetamide is used as a key intermediate in the development of compounds that can protect crops from pests and diseases, leveraging its antimicrobial characteristics.
Used in Organic Chemistry Research:
1H-Benzimidazole-2-acetamide serves as a versatile intermediate in organic synthesis, contributing to the advancement of research in medicinal chemistry and drug discovery. Its unique structure allows for the creation of a wide range of derivative compounds for various applications.
The diverse applications of 1H-Benzimidazole-2-acetamide underscore its importance in the development of new therapeutic agents and chemical compounds, making it a valuable asset in the fields of medicine and agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 60792-56-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,7,9 and 2 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 60792-56:
(7*6)+(6*0)+(5*7)+(4*9)+(3*2)+(2*5)+(1*6)=135
135 % 10 = 5
So 60792-56-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O/c10-8(13)5-9-11-6-3-1-2-4-7(6)12-9/h1-4H,5H2,(H2,10,13)(H,11,12)
