60903-83-5 Usage
Uses
Used in Pharmaceutical Industry:
4-Chloro-2,3,5,6-tetrafluorobenzylchloride is used as a reagent or intermediate for the production of various pharmaceuticals. Its unique chemical properties make it a valuable building block for the development of complex organic molecules.
Used in Agrochemical Industry:
4-Chloro-2,3,5,6-tetrafluorobenzylchloride is also used in the production of agrochemicals, contributing to the development of effective and efficient products for agricultural applications.
Used in Fine Chemicals Industry:
4-Chloro-2,3,5,6-tetrafluorobenzylchloride is utilized in the synthesis of other fine chemicals, further expanding its range of applications across various industries that require specialized chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 60903-83-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,9,0 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 60903-83:
(7*6)+(6*0)+(5*9)+(4*0)+(3*3)+(2*8)+(1*3)=115
115 % 10 = 5
So 60903-83-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H2Cl2F4/c8-1-2-4(10)6(12)3(9)7(13)5(2)11/h1H2
