60903-84-6 Usage
General Description
2,3,5,6-Tetrafluoro-4-methylbenzylchloride is a chemical compound characterized by the presence of fluorine and chlorine atoms in its molecular structure. Its molecular formula is C8H4ClF4. As identified by its name, it contains four fluorine atoms and one chlorine atom attached to a benzyl ring, which is essentially a ring of six carbon atoms, one of which is also attached to a methyl group. 2,3,5,6-Tetrafluoro-4-methylbenzylchloride is used extensively in the field of synthetic organic chemistry, where it can serve as a precursor for other complex molecules. While its exact properties can vary depending on the conditions, it is generally required to handle it with care due to the reactive nature of halogens.
Check Digit Verification of cas no
The CAS Registry Mumber 60903-84-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,9,0 and 3 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 60903-84:
(7*6)+(6*0)+(5*9)+(4*0)+(3*3)+(2*8)+(1*4)=116
116 % 10 = 6
So 60903-84-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClF4/c1-3-5(10)7(12)4(2-9)8(13)6(3)11/h2H2,1H3
