609771-39-3 Usage
Uses
Used in Organic Synthesis:
2-Fluoro-3-formyl-4-picoline is used as a key intermediate in organic synthesis for the preparation of various complex organic molecules. Its unique structure and reactivity facilitate the formation of diverse chemical entities, contributing to the advancement of organic chemistry.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 2-Fluoro-3-formyl-4-picoline is employed as a building block for the synthesis of various drugs. Its presence in the molecular structure can influence the pharmacological properties of the resulting compounds, such as potency, selectivity, and metabolic stability, thereby enhancing their therapeutic potential.
Used in Agrochemical Development:
2-Fluoro-3-formyl-4-picoline also finds application in the agrochemical sector, where it is used as a precursor for the development of novel pesticides and herbicides. The incorporation of the fluorine atom can improve the biological activity and environmental persistence of these agrochemicals, leading to more effective and sustainable solutions for crop protection.
Used in Research and Development:
Due to its unique chemical properties, 2-Fluoro-3-formyl-4-picoline is a valuable compound for research and development in various scientific fields. It can be used to explore new reaction mechanisms, investigate the effects of fluorination on molecular properties, and develop innovative synthetic methodologies, thereby expanding the frontiers of chemical knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 609771-39-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,0,9,7,7 and 1 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 609771-39:
(8*6)+(7*0)+(6*9)+(5*7)+(4*7)+(3*1)+(2*3)+(1*9)=183
183 % 10 = 3
So 609771-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H6FNO/c1-5-2-3-9-7(8)6(5)4-10/h2-4H,1H3
