609781-30-8 Usage
Uses
Used in Pharmaceutical Industry:
4-(PIPERIDIN-4-YLOXY)BENZAMIDE is used as a potential drug candidate for the treatment of neurological disorders due to its pharmacological properties that may help in managing such conditions.
Used in Oncology:
4-(PIPERIDIN-4-YLOXY)BENZAMIDE is used as a potential anticancer agent, given its potential to target and treat various types of cancer. Its specific application in oncology may involve the modulation of cellular pathways and mechanisms that contribute to tumor growth and progression.
Used in Drug Development Research:
4-(PIPERIDIN-4-YLOXY)BENZAMIDE is used as a valuable compound for research in the field of pharmaceuticals, where its unique structure and properties are further explored to understand its therapeutic potential and optimize its use in drug formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 609781-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,0,9,7,8 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 609781-30:
(8*6)+(7*0)+(6*9)+(5*7)+(4*8)+(3*1)+(2*3)+(1*0)=178
178 % 10 = 8
So 609781-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2O2/c13-12(15)9-1-3-10(4-2-9)16-11-5-7-14-8-6-11/h1-4,11,14H,5-8H2,(H2,13,15)
