61038-97-9 Usage
General Description
Methyl 4-[[2-(acetylamino)-4-[bis(3-methoxy-3-oxopropyl)amino]phenyl]azo]benzoate is a complex organic compound consisting of a methyl ester group attached to a benzoate ring, with an azo group (N=N) linking a diazonium group to a phenyl group. The compound also contains multiple amine and acetyl functional groups, as well as methoxy and oxopropyl groups. This chemical is commonly used as a colorant or dye in various industries, due to its vibrant and long-lasting color properties. Additionally, it may also possess pharmacological properties and is being explored for potential therapeutic applications. Overall, methyl 4-[[2-(acetylamino)-4-[bis(3-methoxy-3-oxopropyl)amino]phenyl]azo]benzoate is a versatile and complex chemical compound with a variety of potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 61038-97-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,0,3 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 61038-97:
(7*6)+(6*1)+(5*0)+(4*3)+(3*8)+(2*9)+(1*7)=109
109 % 10 = 9
So 61038-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C24H28N4O7/c1-16(29)25-21-15-19(28(13-11-22(30)33-2)14-12-23(31)34-3)9-10-20(21)27-26-18-7-5-17(6-8-18)24(32)35-4/h5-10,15H,11-14H2,1-4H3,(H,25,29)/b27-26+