61049-90-9 Usage
Butyl group
A four-carbon alkyl group attached to the compound
Primary amine
A functional group containing a nitrogen atom bonded to two hydrogen atoms
Azo compound
A compound containing a nitrogen-nitrogen double bond (-N=N-) linked to aromatic rings
Phenyl group
A six-carbon aromatic ring attached to the azo compound
Thiadiazolyl group
An organic compound containing a five-membered ring with nitrogen and sulfur atoms attached to the azo compound
Ethanol group
A functional group containing a hydroxyl group (-OH) attached to a two-carbon chain
Potential applications
Organic synthesis, pharmaceuticals, materials science
Use as a dye or pigment
Due to the presence of the azo group
Potential use as a surfactant or emulsifier
Due to the amine and alcohol groups
Biological activity or pharmaceutical potential
Due to the presence of the phenyl and thiadiazolyl groups
Further research and testing needed
To fully understand the compound's properties and potential uses
Check Digit Verification of cas no
The CAS Registry Mumber 61049-90-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,0,4 and 9 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 61049-90:
(7*6)+(6*1)+(5*0)+(4*4)+(3*9)+(2*9)+(1*0)=109
109 % 10 = 9
So 61049-90-9 is a valid CAS Registry Number.
InChI:InChI=1/C20H23N5OS/c1-2-3-13-25(14-15-26)18-11-9-17(10-12-18)22-23-20-21-19(24-27-20)16-7-5-4-6-8-16/h4-12,26H,2-3,13-15H2,1H3/b23-22+