61152-07-6 Usage
Chemical classification
oxazole derivative
Molecular weight
220.2 g/mol
Usage
pharmaceutical research and drug development
Potential biological activities
yes
+ m-fluorophenyl group
provides specific properties
+ oxazole ring
contributes to potential pharmacological activity
+ carboxamide functional group
contributes to potential pharmacological activity
Importance
key chemical for medicinal chemistry research
Future applications
potential use in drug discovery
Check Digit Verification of cas no
The CAS Registry Mumber 61152-07-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,1,5 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 61152-07:
(7*6)+(6*1)+(5*1)+(4*5)+(3*2)+(2*0)+(1*7)=86
86 % 10 = 6
So 61152-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H9FN2O2/c1-6-9(10(13)15)14-11(16-6)7-3-2-4-8(12)5-7/h2-5H,1H3,(H2,13,15)