61167-19-9 Usage
Description
(3,4-Diaminophenyl) 2-thienylketone hydrochloride, also known as (3,4-Diaminophenyl)-(2-thienyl)methanone monohydrochloride, is a brown crystalline solid compound with the CAS number 61167-19-9. It is primarily used in organic synthesis due to its unique chemical structure and properties.
Uses
Used in Organic Synthesis:
(3,4-Diaminophenyl) 2-thienylketone hydrochloride is used as a synthetic intermediate for the development of various organic compounds. Its application in this field is due to its unique chemical structure, which allows for the creation of a wide range of molecules with different properties and functionalities.
Used in Pharmaceutical Industry:
(3,4-Diaminophenyl) 2-thienylketone hydrochloride is used as a building block for the synthesis of pharmaceutical compounds. Its presence in the molecular structure can contribute to the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
(3,4-Diaminophenyl) 2-thienylketone hydrochloride is used as a research compound in the field of chemistry. It can be employed to study various chemical reactions and mechanisms, as well as to understand the properties and behavior of similar compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 61167-19-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,1,6 and 7 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 61167-19:
(7*6)+(6*1)+(5*1)+(4*6)+(3*7)+(2*1)+(1*9)=109
109 % 10 = 9
So 61167-19-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2OS.ClH/c12-8-4-3-7(6-9(8)13)11(14)10-2-1-5-15-10;/h1-6H,12-13H2;1H