6120-26-9 Usage
Uses
Used in Pharmaceutical Industry:
6-Bromo-1,3-benzodioxole-5-carbonitrile is used as a key intermediate in the synthesis of various drugs, contributing to the development of new therapeutic agents. Its unique structure allows for the creation of diverse chemical entities with potential medicinal applications.
Used in Agrochemical Industry:
In the agrochemical sector, 6-Bromo-1,3-benzodioxole-5-carbonitrile serves as a building block for the synthesis of agrochemical products, such as pesticides and herbicides. Its incorporation into these products can enhance their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Organic Synthesis:
6-Bromo-1,3-benzodioxole-5-carbonitrile is utilized as a reagent in organic synthesis reactions, enabling the formation of a wide range of chemical compounds. Its presence in these reactions can facilitate the synthesis of complex molecules with specific properties, broadening the scope of chemical research and development.
Used in Biological and Pharmacological Research:
6-BROMO-1,3-BENZODIOXOLE-5-CARBONITRILE is employed in biological and pharmacological studies to explore its potential effects on various biological systems. Research on 6-Bromo-1,3-benzodioxole-5-carbonitrile can lead to a better understanding of its interactions with biological targets, potentially uncovering new therapeutic opportunities and advancing drug discovery efforts.
Check Digit Verification of cas no
The CAS Registry Mumber 6120-26-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,1,2 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6120-26:
(6*6)+(5*1)+(4*2)+(3*0)+(2*2)+(1*6)=59
59 % 10 = 9
So 6120-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H4BrNO2/c9-6-2-8-7(11-4-12-8)1-5(6)3-10/h1-2H,4H2
6120-26-9Relevant academic research and scientific papers
Ruthenium-catalyzed intramolecular selective halogenation of O-methylbenzohydroximoyl halides: A new route to halogenated aromatic nitriles
Chinnagolla, Ravi Kiran,Pimparkar, Sandeep,Jeganmohan, Masilamani
supporting information, p. 3146 - 3148 (2013/06/04)
The intramolecular halogenation of O-methylbenzohydroximoyl halides in the presence of a Ru catalyst and the ligand diphenylacetylene afforded halo substituted aromatic nitriles in a highly regioselective manner. Further, substituted nitriles were converted into substituted tetrazole derivatives in the presence of NaN3 and I2.
