61259-69-6 Usage
Description
3,4-Dichlorobenzylmagnesium chloride is an organometallic compound that consists of a benzyl group with two chlorine atoms at the 3rd and 4th positions, attached to a magnesium chloride. It is a significant reagent in organic synthesis due to its unique chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
3,4-Dichlorobenzylmagnesium chloride is used as a pharmaceutical intermediate for the synthesis of various drugs and medicinal compounds. Its organometallic nature allows it to participate in a range of reactions, such as Grignard reactions, which are crucial for constructing complex molecular structures in the pharmaceutical field.
Check Digit Verification of cas no
The CAS Registry Mumber 61259-69-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,2,5 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 61259-69:
(7*6)+(6*1)+(5*2)+(4*5)+(3*9)+(2*6)+(1*9)=126
126 % 10 = 6
So 61259-69-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H5Cl2.ClH.Mg/c1-5-2-3-6(8)7(9)4-5;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5Cl3Mg/c8-6-2-1-5(4-11-10)3-7(6)9/h1-3H,4H2
