61273-95-8 Usage
General Description
1-benzyl-1,2,5,6-tetrahydro-2-[(4-methoxyphenyl)methyl]-3,4-dimethylpyridinium hydrogen oxalate is a chemical compound that belongs to the class of pyridinium salts. It is a quaternary ammonium compound, which means it contains a positively charged nitrogen atom. The chemical structure of this compound consists of a benzyl group, a methoxyphenylmethyl group, and a dimethylpyridinium group, all connected to a tetrahydro-2 backbone. It also contains a hydrogen oxalate group, which is a salt consisting of oxalic acid and hydrogen ions. 1-benzyl-1,2,5,6-tetrahydro-2-[(4-methoxyphenyl)methyl]-3,4-dimethylpyridinium hydrogen oxalate may have various applications in the pharmaceutical, chemical, or research industries, due to its unique structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 61273-95-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,2,7 and 3 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 61273-95:
(7*6)+(6*1)+(5*2)+(4*7)+(3*3)+(2*9)+(1*5)=118
118 % 10 = 8
So 61273-95-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H27NO.C2H2O4/c1-17-13-14-23(16-20-7-5-4-6-8-20)22(18(17)2)15-19-9-11-21(24-3)12-10-19;3-1(4)2(5)6/h4-12,22H,13-16H2,1-3H3;(H,3,4)(H,5,6)