61286-62-2 Usage
Uses
Used in Organic Synthesis:
2,5-Dimethoxybenzenediazonium hexafluorophosphate is used as a diazo transfer reagent for the formation of highly reactive intermediates in organic synthesis. Its application is crucial in the creation of a wide range of organic compounds due to its versatility and reactivity.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2,5-Dimethoxybenzenediazonium hexafluorophosphate is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its ability to transfer the diazo group allows for the development of new drug molecules with specific therapeutic properties.
Used in Agrochemical Synthesis:
2,5-Dimethoxybenzenediazonium hexafluorophosphate is employed as a reagent in the synthesis of agrochemicals, contributing to the development of new pesticides and other agricultural chemicals that can improve crop protection and yield.
Used in Fine Chemicals Synthesis:
This diazonium salt is also used in the synthesis of fine chemicals, where its reactivity and ability to form reactive intermediates are harnessed to produce specialty chemicals for various applications, including fragrances, dyes, and other high-value products.
Check Digit Verification of cas no
The CAS Registry Mumber 61286-62-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,2,8 and 6 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 61286-62:
(7*6)+(6*1)+(5*2)+(4*8)+(3*6)+(2*6)+(1*2)=122
122 % 10 = 2
So 61286-62-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N2O2.F6P/c1-11-6-3-4-8(12-2)7(5-6)10-9;1-7(2,3,4,5)6/h3-5H,1-2H3;/q+1;-1
