61296-10-4 Usage
Main properties
versatile, potential for diverse applications
Specific content
1. Used in the pharmaceutical industry as an intermediate for synthesis of various organic compounds
2. Used in development of pharmaceuticals, agrochemicals, and dyes
3. Acts as a building block for creation of biologically active molecules
4. Utilized in development of new drug candidates
5. Potential applications in organic chemistry and drug discovery
Check Digit Verification of cas no
The CAS Registry Mumber 61296-10-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,2,9 and 6 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 61296-10:
(7*6)+(6*1)+(5*2)+(4*9)+(3*6)+(2*1)+(1*0)=114
114 % 10 = 4
So 61296-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H3ClN4O2/c5-3-1-2-4(7-6-3)8-9(10)11/h1-2H,(H,7,8)