613-23-0 Usage
Uses
Used in Chemical Research:
1,2-Phenylenediacetonitrile is used as a research compound for its unique chemical properties, contributing to the development of new chemical entities and understanding of chemical reactions.
Used in Pharmaceutical Industry:
1,2-Phenylenediacetonitrile is used as a key intermediate in the synthesis of various pharmaceutical compounds, facilitating the production of drugs with specific therapeutic applications.
Used in Agrochemical Industry:
1,2-Phenylenediacetonitrile is used as a starting material in the production of agrochemicals, such as pesticides and herbicides, due to its reactivity and ability to form complex molecules.
Used in Dye and Pigment Industry:
1,2-Phenylenediacetonitrile is used as a precursor in the synthesis of dyes and pigments, contributing to the creation of vibrant colors and hues in various applications.
Used in Polymer Industry:
1,2-Phenylenediacetonitrile is used as a monomer in the production of polymers, such as plastics and resins, due to its ability to form stable polymer chains with desirable properties.
Check Digit Verification of cas no
The CAS Registry Mumber 613-23-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,1 and 3 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 613-23:
(5*6)+(4*1)+(3*3)+(2*2)+(1*3)=50
50 % 10 = 0
So 613-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2/c11-7-5-9-3-1-2-4-10(9)6-8-12/h1-4H,5-6H2
