61336-49-0 Usage
Uses
Used in Pharmaceutical Industry:
SODIUM 2-(5-SULFIDO-1H-TETRAZOL-1-YL)ACETATE is used as a reagent for the preparation of various drugs, leveraging its unique chemical structure to facilitate the synthesis process and enhance the properties of the resulting pharmaceuticals.
Used in Synthesis of New Polymers and Materials:
In the field of materials science, SODIUM 2-(5-SULFIDO-1H-TETRAZOL-1-YL)ACETATE is used as a building block for the development of new polymers and materials, taking advantage of its chemical properties to create innovative products with improved characteristics.
Used in Medicinal Chemistry and Drug Discovery:
Due to its diverse biological activities, SODIUM 2-(5-SULFIDO-1H-TETRAZOL-1-YL)ACETATE is used as a compound of interest in medicinal chemistry and drug discovery, potentially leading to the identification of new therapeutic agents and contributing to advancements in healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 61336-49-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,3,3 and 6 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 61336-49:
(7*6)+(6*1)+(5*3)+(4*3)+(3*6)+(2*4)+(1*9)=110
110 % 10 = 0
So 61336-49-0 is a valid CAS Registry Number.
InChI:InChI=1/C3H4N4O2S.2Na/c8-2(9)1-7-3(10)4-5-6-7;;/h1H2,(H,8,9)(H,4,6,10);;/q;2*+1/p-2
