614-94-8 Usage
Uses
Used in Dye and Pigment Production:
2,4-DIAMINOANISOLE DIHYDROCHLORIDE is used as an intermediate in the production of dyes and pigments for various applications, such as textiles, plastics, and printing inks. Its chemical structure allows for the creation of a wide range of colorants with different properties.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2,4-DIAMINOANISOLE DIHYDROCHLORIDE is utilized as a key intermediate in the synthesis of various drugs. Its unique chemical properties enable the development of new medications with specific therapeutic effects.
Used in Hair Dye Formulation:
2,4-DIAMINOANISOLE DIHYDROCHLORIDE is used as an active ingredient in hair dyes, providing coloration and enhancing the appearance of hair. Its chemical composition allows for the formation of stable color complexes within the hair shaft, resulting in long-lasting and vibrant color.
Safety Precautions:
As a skin and eye irritant, it is crucial to handle 2,4-DIAMINOANISOLE DIHYDROCHLORIDE with care. Proper protective equipment, such as gloves, goggles, and lab coats, should be worn when working with this chemical. Additionally, safety guidelines and protocols should be followed to minimize the risk of exposure and potential health hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 614-94-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,1 and 4 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 614-94:
(5*6)+(4*1)+(3*4)+(2*9)+(1*4)=68
68 % 10 = 8
So 614-94-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O.2ClH/c1-10-7-3-2-5(8)4-6(7)9;;/h2-4H,8-9H2,1H3;2*1H
