61404-50-0 Usage
Uses
Used in Pharmaceutical Industry:
5-ethylpyridazin-3(2H)-one is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs with potential therapeutic applications. Its presence in the molecular structure can enhance the pharmacological properties of the final product.
Used in Agrochemical Industry:
5-ethylpyridazin-3(2H)-one is used as a building block in the creation of agrochemicals, specifically for the development of pesticides and other crop protection agents. Its incorporation can lead to the design of more effective and targeted agrochemicals.
Used in Antiviral Applications:
5-ethylpyridazin-3(2H)-one is utilized as an antiviral agent due to its potential to inhibit viral replication and reduce the severity of viral infections. Its antiviral properties make it a valuable component in the development of treatments for various viral diseases.
Used in Analgesic Formulations:
Leveraging its analgesic properties, 5-ethylpyridazin-3(2H)-one is used in the formulation of pain relief medications. Its ability to alleviate pain makes it a beneficial component in the creation of new and improved analgesic drugs.
Used in Research and Development:
5-ethylpyridazin-3(2H)-one serves as a valuable compound in scientific research and development, particularly in the fields of medicinal chemistry and biochemistry. Its unique structure and properties make it an ideal candidate for studying molecular interactions and developing new therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 61404-50-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,4,0 and 4 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 61404-50:
(7*6)+(6*1)+(5*4)+(4*0)+(3*4)+(2*5)+(1*0)=90
90 % 10 = 0
So 61404-50-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O/c1-2-5-3-6(9)8-7-4-5/h3-4H,2H2,1H3,(H,8,9)
