61494-61-9 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
(2-Amino-pyridin-3-yl)-acetic acid is used as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure allows it to be a valuable component in the development of new drugs and pesticides, contributing to advancements in healthcare and agriculture.
Used in Materials Science:
In the field of materials science, (2-Amino-pyridin-3-yl)-acetic acid is utilized for its potential applications in creating new materials with specific properties. Its chemical structure lends itself to the design and synthesis of materials with tailored characteristics for various uses.
Used in Organic Chemistry Research:
(2-Amino-pyridin-3-yl)-acetic acid serves as a versatile compound in organic chemistry research. It is employed in the exploration of new synthetic pathways, the development of novel reactions, and the study of chemical properties and behaviors of related compounds.
Used in Biological Research:
(2-Amino-pyridin-3-yl)-acetic acid has been studied for its potential biological activities, including its role as a potential antitumor agent. Its presence in biological systems is of interest to researchers seeking to understand its impact on cellular processes and its potential use in therapeutic applications.
Overall, (2-Amino-pyridin-3-yl)-acetic acid is a multifaceted compound with applications spanning from the synthesis of pharmaceuticals and agrochemicals to its use in materials science and organic chemistry research, as well as its potential role in biological research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 61494-61-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,4,9 and 4 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 61494-61:
(7*6)+(6*1)+(5*4)+(4*9)+(3*4)+(2*6)+(1*1)=129
129 % 10 = 9
So 61494-61-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c8-7-5(4-6(10)11)2-1-3-9-7/h1-3H,4H2,(H2,8,9)(H,10,11)
