61512-21-8 Usage
General Description
Thymosin α1 is a synthetic version of a naturally occurring peptide hormone found in the thymus gland, which plays a crucial role in modulating the immune response. It has been studied for its ability to enhance the function of various immune cells, such as T-cells, B-cells, and natural killer cells, and has shown promise in boosting the body's immune defenses against infections, cancer, and autoimmune diseases. Thymosin α1 has also been investigated for its potential to reduce inflammation and promote tissue repair, making it a potential candidate for treating a range of immune-related conditions. Overall, it is considered a promising immunomodulatory agent with potential therapeutic applications in various medical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 61512-21-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,5,1 and 2 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 61512-21:
(7*6)+(6*1)+(5*5)+(4*1)+(3*2)+(2*2)+(1*1)=88
88 % 10 = 8
So 61512-21-8 is a valid CAS Registry Number.
InChI:InChI=1/C129H215N33O55/c1-18-59(10)98(159-114(201)76(36-42-91(181)182)146-120(207)83(53-164)154-121(208)84(54-165)155-127(214)99(63(14)166)160-118(205)80(51-94(187)188)152-123(210)95(56(4)5)156-104(191)62(13)135-102(189)60(11)137-115(202)78(49-92(183)184)151-119(206)82(52-163)138-66(17)169)125(212)161-101(65(16)168)128(215)162-100(64(15)167)126(213)147-70(30-22-26-46-133)109(196)150-79(50-93(185)186)117(204)149-77(47-55(2)3)116(203)142-69(29-21-25-45-132)108(195)144-73(33-39-88(175)176)110(197)141-67(27-19-23-43-130)106(193)140-68(28-20-24-44-131)107(194)145-75(35-41-90(179)180)113(200)157-97(58(8)9)124(211)158-96(57(6)7)122(209)148-74(34-40-89(177)178)111(198)143-71(31-37-86(171)172)105(192)136-61(12)103(190)139-72(32-38-87(173)174)112(199)153-81(129(216)217)48-85(134)170/h55-65,67-84,95-101,163-168H,18-54,130-133H2,1-17H3,(H2,134,170)(H,135,189)(H,136,192)(H,137,202)(H,138,169)(H,139,190)(H,140,193)(H,141,197)(H,142,203)(H,143,198)(H,144,195)(H,145,194)(H,146,207)(H,147,213)(H,148,209)(H,149,204)(H,150,196)