6152-25-6 Usage
Uses
Used in Pharmaceutical Synthesis:
2-hydrazinyl-2-oxo-N-(1-phenylethyl)acetamide is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the creation of new drugs with potential therapeutic benefits.
Used in Chemical Reactions as a Reagent:
In the realm of chemical research and development, 2-hydrazinyl-2-oxo-N-(1-phenylethyl)acetamide serves as a versatile reagent, facilitating a range of chemical reactions that can lead to the production of novel compounds with diverse applications.
Used in Anti-inflammatory Applications:
2-hydrazinyl-2-oxo-N-(1-phenylethyl)acetamide is used as an anti-inflammatory agent, leveraging its pharmacological properties to potentially alleviate inflammation and associated symptoms in various conditions.
Used in Anti-cancer Applications:
In the field of oncology, 2-hydrazinyl-2-oxo-N-(1-phenylethyl)acetamide is explored as an anti-cancer agent. Its potential to target and inhibit the growth of cancer cells makes it a candidate for further research into its efficacy and mechanisms of action in combating cancer.
Used in Research and Development:
2-hydrazinyl-2-oxo-N-(1-phenylethyl)acetamide is utilized in research and development settings to investigate its properties and potential applications further. This includes studies on its pharmacological effects, interactions with biological systems, and its role in the synthesis of new compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 6152-25-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,1,5 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6152-25:
(6*6)+(5*1)+(4*5)+(3*2)+(2*2)+(1*5)=76
76 % 10 = 6
So 6152-25-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3O2/c1-7(8-5-3-2-4-6-8)12-9(14)10(15)13-11/h2-7H,11H2,1H3,(H,12,14)(H,13,15)/t7-/m0/s1
