61551-61-9 Usage
General Description
(Dodecylbenzyl)dimethylsulphonium chloride is a quaternary ammonium compound that is often used as a biocidal disinfectant and preservative in various industrial and commercial applications. It is a highly effective antimicrobial agent and is commonly used in water treatment, food processing, and healthcare settings to control the growth and spread of bacteria, fungi, and algae. (dodecylbenzyl)dimethylsulphonium chloride works by disrupting the cell membranes of microorganisms, leading to their destruction and inhibition of further growth. It is also known for its ability to effectively deodorize and decontaminate surfaces, making it a valuable ingredient in various cleaning and sanitizing products. Additionally, it is considered to be relatively safe for use and is approved for use in food contact surfaces and medical devices.
Check Digit Verification of cas no
The CAS Registry Mumber 61551-61-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,5,5 and 1 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 61551-61:
(7*6)+(6*1)+(5*5)+(4*5)+(3*1)+(2*6)+(1*1)=109
109 % 10 = 9
So 61551-61-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H37S.ClH/c1-4-5-6-7-8-9-10-11-12-13-16-20-17-14-15-18-21(20)19-22(2)3;/h14-15,17-18H,4-13,16,19H2,1-3H3;1H/q+1;/p-1
