61689-98-3 Usage
Uses
Used in Pharmaceutical Industry:
1H-Benzimidazole-2-ethanethioamide(9CI) is used as a potential active pharmaceutical ingredient for the development of anti-parasitic and anti-cancer drugs due to its unique chemical structure and potential biological activities.
Used in Chemical Synthesis:
1H-Benzimidazole-2-ethanethioamide(9CI) is used as a chemical intermediate in the synthesis of other compounds, contributing to the creation of novel pharmaceuticals and chemical products.
Further research and testing are necessary to determine the specific applications and optimize the use of 1H-Benzimidazole-2-ethanethioamide(9CI) in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 61689-98-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,6,8 and 9 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 61689-98:
(7*6)+(6*1)+(5*6)+(4*8)+(3*9)+(2*9)+(1*8)=163
163 % 10 = 3
So 61689-98-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3S/c10-8(13)5-9-11-6-3-1-2-4-7(6)12-9/h1-4H,5H2,(H2,10,13)(H,11,12)
