61788-32-7 Usage
Description
Terphenyl, hydrogenated is a clear, oily, pale-yellow liquid with a faint odor. It is a mixture of numerous compounds and isomers that vary depending on the degree and conditions of hydrogenation. The 40% hydrogenated mixture has a boiling point of 340°C, a density of 1.00 g cm-3, and is insoluble in water.
Uses
Used in Plasticizer Industry:
Terphenyl, hydrogenated is used as a plasticizer to increase the flexibility and workability of various materials, such as polymers and resins. Its chemical structure allows it to interact with the polymer chains, reducing their intermolecular forces and enhancing their plasticity.
Used in Heat Transfer Medium Industry:
Terphenyl, hydrogenated is used as a heat-transfer medium in industrial applications due to its high boiling point and thermal stability. It can efficiently transfer heat in processes such as heating or cooling systems, ensuring optimal temperature control and energy efficiency.
Reactivity Profile
Terphenyl, hydrogenated are non-flammable (flash-point 157°C for 40% hydrogenated mixture), but combustible. Resist decomposition but break down to produce acrid smoke when heated sufficiently. Incompatible with strong oxidizing agents.
Check Digit Verification of cas no
The CAS Registry Mumber 61788-32-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,7,8 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 61788-32:
(7*6)+(6*1)+(5*7)+(4*8)+(3*8)+(2*3)+(1*2)=147
147 % 10 = 7
So 61788-32-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H22/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1,3,5,9,11-16H,2,4,6-8,10H2
