618070-43-2 Usage
Uses
Used in Pharmaceutical Industry:
1-(4-Fluorobenzyl)-3-methyl-1H-pyrazole is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 1-(4-Fluorobenzyl)-3-methyl-1H-pyrazole is used as a precursor for the production of agrochemicals, such as pesticides and herbicides. Its reactivity enables the creation of effective compounds for crop protection and management.
Used in Research and Development:
1-(4-Fluorobenzyl)-3-methyl-1H-pyrazole is utilized in research and development for its potential applications in the fields of chemistry and medicine. Its unique structure and reactivity make it a valuable compound for exploring new chemical reactions and synthesizing novel compounds with potential therapeutic or agricultural benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 618070-43-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,1,8,0,7 and 0 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 618070-43:
(8*6)+(7*1)+(6*8)+(5*0)+(4*7)+(3*0)+(2*4)+(1*3)=142
142 % 10 = 2
So 618070-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H11FN2O2/c1-8-6-11(12(16)17)15(14-8)7-9-2-4-10(13)5-3-9/h2-6H,7H2,1H3,(H,16,17)
