618092-46-9 Usage
Uses
Used in Pharmaceutical Industry:
1-(4-METHOXY-PHENYL)-5-METHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID HYDRAZIDE is used as a pharmaceutical intermediate for the synthesis of various compounds with potential medicinal properties. Its unique chemical structure and reactivity contribute to the development of new drug molecules and other biologically active compounds.
Used in Scientific Research:
1-(4-METHOXY-PHENYL)-5-METHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID HYDRAZIDE is used as a research compound to explore its potential biological activities and investigate its applications in various fields, such as materials science and chemical synthesis.
Used in Chemical Synthesis:
1-(4-METHOXY-PHENYL)-5-METHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID HYDRAZIDE is used as a valuable building block in chemical synthesis, enabling the creation of new compounds with potential applications in various industries, including pharmaceuticals and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 618092-46-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,1,8,0,9 and 2 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 618092-46:
(8*6)+(7*1)+(6*8)+(5*0)+(4*9)+(3*2)+(2*4)+(1*6)=159
159 % 10 = 9
So 618092-46-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N4O2/c1-8-11(12(17)15-13)7-14-16(8)9-3-5-10(18-2)6-4-9/h3-7H,13H2,1-2H3,(H,15,17)
