618101-91-0 Usage
Pyrazole derivative
A compound based on the pyrazole structure This indicates that the compound is derived from the pyrazole core structure, which is a five-membered heterocyclic ring containing two nitrogen atoms.
Carboxylic acid functional group
Presence of -COOH group This refers to the presence of a carboxyl group (-COOH) in the compound, which is a common functional group in organic chemistry and is known for its acidic properties.
Synthesis in pharmaceuticals and agrochemicals
Used as an intermediate in the production of drugs and pesticides This highlights the compound's potential applications in the synthesis of various pharmaceutical and agrochemical products due to its biological activities.
Potential biological activities
Antimicrobial, anti-inflammatory, and anticancer properties These are the possible biological effects that the compound may exhibit, making it a valuable intermediate in the development of new drugs.
Building block in organic synthesis
Can be used to create a variety of compounds with diverse pharmacological activities This suggests that the compound can serve as a starting material for the synthesis of other compounds with different therapeutic and biological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 618101-91-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,1,8,1,0 and 1 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 618101-91:
(8*6)+(7*1)+(6*8)+(5*1)+(4*0)+(3*1)+(2*9)+(1*1)=130
130 % 10 = 0
So 618101-91-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H11BrN2O2/c17-12-6-8-13(9-7-12)19-15(16(20)21)10-14(18-19)11-4-2-1-3-5-11/h1-10H,(H,20,21)
