61827-59-6 Usage
Uses
Used in Synthetic Organic Chemistry:
1,3-Dibromo-4-methoxy-2-methyl-5-nitrobenzene is used as a building block for synthesizing more complex molecules, particularly in the field of synthetic organic chemistry. Its unique combination of functional groups allows for further manipulation in chemical reactions, making it a valuable component in the synthesis of various compounds.
Used in Industrial Production Processes:
1,3-Dibromo-4-methoxy-2-methyl-5-nitrobenzene is used as an intermediate in different industrial production processes. Its versatility and reactivity make it suitable for use in the manufacturing of various products, such as pharmaceuticals, dyes, and other specialty chemicals. 1,3-Dibromo-4-methoxy-2-methyl-5-nitrobenzene's properties can be tailored to meet specific requirements in these industries, making it an essential component in their production processes.
Check Digit Verification of cas no
The CAS Registry Mumber 61827-59-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,8,2 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 61827-59:
(7*6)+(6*1)+(5*8)+(4*2)+(3*7)+(2*5)+(1*9)=136
136 % 10 = 6
So 61827-59-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H7Br2NO3/c1-4-5(9)3-6(11(12)13)8(14-2)7(4)10/h3H,1-2H3
