618382-86-8 Usage
Classification
Pyrazole carboxylic acids
Belongs to a group of chemical compounds that contain a pyrazole ring and a carboxylic acid functional group.
Fluoro-substituted phenyl group
A phenyl group (benzene ring) with fluorine atoms as substituents.
Thiophene ring
A five-membered heterocyclic ring with one sulfur atom and four carbon atoms.
Pyrazole-3-carboxylic acid core structure
A five-membered heterocyclic ring with two nitrogen atoms and a carboxylic acid functional group attached to the third carbon.
Application
Medicinal chemistry research and drug development
Utilized in the study of potential biological activities and as an inhibitor of certain enzymes or receptors.
Biological activity
Potential enzyme or receptor inhibitor
Exhibits the ability to interact with biological targets, which may lead to the development of new pharmaceuticals.
Value in research
Structure-activity relationships
The unique structure and functional groups of the compound make it a valuable tool for understanding how structural changes affect biological activity, aiding in the exploration of new pharmaceutical possibilities.
Check Digit Verification of cas no
The CAS Registry Mumber 618382-86-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,1,8,3,8 and 2 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 618382-86:
(8*6)+(7*1)+(6*8)+(5*3)+(4*8)+(3*2)+(2*8)+(1*6)=178
178 % 10 = 8
So 618382-86-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H8F2N2O2S/c15-8-3-4-11(9(16)6-8)18-12(14(19)20)7-10(17-18)13-2-1-5-21-13/h1-7H,(H,19,20)
