61852-40-2 Usage
Uses
Used in Pharmaceutical Synthesis:
3-(Butylphenylamino)propiononitrile is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drug molecules.
Used in Agrochemical Production:
In the agrochemical industry, 3-(Butylphenylamino)propiononitrile is used as a precursor in the production of agrochemicals, aiding in the creation of compounds that can protect crops from pests and diseases.
Used in Organic Compounds Production:
3-(Butylphenylamino)propiononitrile is used as an intermediate in the synthesis of organic compounds, playing a crucial role in the formation of complex organic molecules for various applications.
Used in Dyes and Pigments Manufacturing:
In the manufacturing of dyes and pigments, 3-(Butylphenylamino)propiononitrile is used to produce a range of colorants for different industries, including textiles, plastics, and printing inks, due to its chemical properties that contribute to color stability and intensity.
Used in Specialty Chemicals Production:
3-(Butylphenylamino)propiononitrile is utilized in the production of specialty chemicals, where its unique chemical structure is leveraged to create high-value compounds for specific industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 61852-40-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,8,5 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 61852-40:
(7*6)+(6*1)+(5*8)+(4*5)+(3*2)+(2*4)+(1*0)=122
122 % 10 = 2
So 61852-40-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H18N2/c1-2-3-11-15(12-7-10-14)13-8-5-4-6-9-13/h4-6,8-9H,2-3,7,11-12H2,1H3
