61855-77-4 Usage
Uses
Used in the Fragrance Industry:
1-methoxymethylnorborn-5-en-2-one is used as a fragrance ingredient for its sweet, floral, and woody aroma, which is often reminiscent of lily of the valley. Its appealing scent profile makes it a valuable addition to perfumes and other fragranced products.
Used in Flavor Production:
In the flavor industry, 1-methoxymethylnorborn-5-en-2-one is used as a flavoring agent to impart complex and pleasant taste notes to various food and beverage products, enhancing their overall sensory experience.
Used in Chemical Synthesis:
1-methoxymethylnorborn-5-en-2-one serves as a key intermediate in the synthesis of other chemical compounds, contributing to the development of new materials and products across multiple chemical sectors.
Used in Pharmaceutical Research:
1-methoxymethylnorborn-5-en-2-one is used as a subject of pharmaceutical research for its potential biological and medicinal properties, including anti-cancer and anti-inflammatory effects. Its unique structure offers opportunities for the development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 61855-77-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,8,5 and 5 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 61855-77:
(7*6)+(6*1)+(5*8)+(4*5)+(3*5)+(2*7)+(1*7)=144
144 % 10 = 4
So 61855-77-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H12O2/c1-11-6-9-3-2-7(5-9)4-8(9)10/h2-3,7H,4-6H2,1H3
