61886-78-0 Usage
Uses
Used in Pharmaceutical Industry:
CBZ-2-AMINO-2-FURANACETIC ACID is used as an intermediate in the synthesis of pharmaceuticals, particularly for the development of antiepileptic drugs. Its unique structure and potential neuroprotective properties make it a promising candidate for the treatment of neurological disorders.
Used in Neurological Disorder Treatment:
CBZ-2-AMINO-2-FURANACETIC ACID is used as a therapeutic agent for the treatment of neurological disorders due to its potential neuroprotective properties. It is being studied for its ability to protect and preserve the function of neurons, which could lead to improved outcomes for patients suffering from such conditions.
Used in Medicinal Chemistry Research:
CBZ-2-AMINO-2-FURANACETIC ACID is used as a valuable chemical in medicinal chemistry research. Its unique structure allows researchers to explore its potential applications in drug development, particularly in the areas of neuroprotection, anti-inflammatory, and anti-cancer properties.
Used in Drug Development:
CBZ-2-AMINO-2-FURANACETIC ACID is used in drug development for its potential applications in various therapeutic areas. Its exploration for anti-inflammatory and anti-cancer properties highlights its versatility and potential as a compound for creating new and effective medications.
Check Digit Verification of cas no
The CAS Registry Mumber 61886-78-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,8,8 and 6 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 61886-78:
(7*6)+(6*1)+(5*8)+(4*8)+(3*6)+(2*7)+(1*8)=160
160 % 10 = 0
So 61886-78-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H13NO5/c16-13(9-12-7-4-8-18-12)20-15-14(17)19-10-11-5-2-1-3-6-11/h1-8H,9-10H2,(H,15,17)
