61892-92-0 Usage
Description
2-(2'-Hydroxyethyl)-3-methylpyrazine is an organic compound with the chemical formula C7H10N2O. It is a heterocyclic compound that belongs to the pyrazine family, characterized by the presence of two nitrogen atoms in a six-membered ring. 2-(2'-HYDROXYETHYL)-3-METHYLPYRAZINE has a hydroxyethyl group attached to the 2-position and a methyl group at the 3-position, which contributes to its unique chemical properties and potential applications.
Uses
Used in Pharmaceutical Industry:
2-(2'-Hydroxyethyl)-3-methylpyrazine is used as a pharmaceutical intermediate for the synthesis of various drugs and active pharmaceutical ingredients. Its unique structure allows it to be a versatile building block in the development of new medications with potential therapeutic benefits.
Used in Chemical Research:
2-(2'-Hydroxyethyl)-3-methylpyrazine is used as a research compound in the investigation of novel compounds and components in various fields, such as cigarette smoke analysis. Its presence in these complex mixtures can provide valuable insights into the chemical composition and potential health effects of such substances.
Used in Flavor and Fragrance Industry:
Due to its unique chemical structure, 2-(2'-Hydroxyethyl)-3-methylpyrazine may also find applications in the flavor and fragrance industry. Its potential use as a flavoring agent or a component in creating specific scents can contribute to the development of new products with distinct olfactory profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 61892-92-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,8,9 and 2 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 61892-92:
(7*6)+(6*1)+(5*8)+(4*9)+(3*2)+(2*9)+(1*2)=150
150 % 10 = 0
So 61892-92-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O/c1-6-7(2-5-10)9-4-3-8-6/h3-4,10H,2,5H2,1H3
