61900-76-3 Usage
Uses
Used in Pharmaceutical Industry:
Pyrrolo[1,2-a]pyrimidine-6-carboxaldehyde (9CI) serves as a valuable building block in the synthesis of pharmaceutical compounds. Its unique structure and functional group make it a promising candidate for the development of new drugs, particularly those targeting tumor growth and inflammation.
Used in Agrochemical Industry:
In the agrochemical sector, Pyrrolo[1,2-a]pyrimidine-6-carboxaldehyde (9CI) is utilized for the synthesis of various agrochemical products. Its potential applications may include the development of pesticides or other compounds that can enhance crop protection and yield.
Used in Organic Synthesis:
Pyrrolo[1,2-a]pyrimidine-6-carboxaldehyde (9CI) is also employed as an intermediate in organic synthesis. Its versatility allows it to be a key component in the creation of a wide range of organic compounds for various applications, from specialty chemicals to advanced materials.
While the specific uses and applications of Pyrrolo[1,2-a]pyrimidine-6-carboxaldehyde (9CI) may vary depending on the context and intended purpose, its presence in these industries highlights its significance and potential in contributing to the development of innovative products and solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 61900-76-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,9,0 and 0 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 61900-76:
(7*6)+(6*1)+(5*9)+(4*0)+(3*0)+(2*7)+(1*6)=113
113 % 10 = 3
So 61900-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O/c11-6-7-2-3-8-9-4-1-5-10(7)8/h1-6H
