61948-67-2 Usage
Uses
Due to the limited information available about 2-amino-5-ethoxy-4-methoxybenzoic acid, its specific applications are not well-documented. However, based on its chemical structure, it can be inferred that it may have potential uses in the following areas:
Used in Pharmaceutical Industry:
2-Amino-5-ethoxy-4-methoxybenzoic acid could be used as a building block or intermediate in the synthesis of pharmaceutical compounds. The presence of the amino, ethoxy, and methoxy groups on the benzoic acid ring may allow for the formation of various derivatives with potential therapeutic applications.
Used in Chemical Research:
2-Amino-5-ethoxy-4-methoxybenzoic acid may serve as a subject of study in chemical research, particularly in the fields of organic chemistry and medicinal chemistry. Its unique structure could be explored for potential reactivity, stability, and interactions with other molecules, leading to the discovery of new chemical reactions or properties.
Used in Material Science:
The specific chemical structure of 2-amino-5-ethoxy-4-methoxybenzoic acid may also make it a candidate for use in material science, particularly in the development of new materials with unique properties. The presence of the amino, ethoxy, and methoxy groups could potentially influence the compound's physical and chemical properties, making it suitable for specific applications in material science.
Check Digit Verification of cas no
The CAS Registry Mumber 61948-67-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,9,4 and 8 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 61948-67:
(7*6)+(6*1)+(5*9)+(4*4)+(3*8)+(2*6)+(1*7)=152
152 % 10 = 2
So 61948-67-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO4/c1-3-15-9-4-6(10(12)13)7(11)5-8(9)14-2/h4-5H,3,11H2,1-2H3,(H,12,13)
