61969-53-7 Usage
Uses
Used in Pharmaceutical Industry:
2,5-Dihydroxy-N-(2-hydroxyethyl)benzamide is used as a potential pharmaceutical agent for its structural similarity to salicylic acid, which is known for its anti-inflammatory and analgesic properties. Its amide group suggests potential for interactions with biological targets, making it a candidate for drug development.
Used in Antioxidant Applications:
Due to the presence of hydroxyl groups, 2,5-Dihydroxy-N-(2-hydroxyethyl)benzamide is used as a potential antioxidant, which may help in protecting cells from oxidative damage and contribute to health and disease prevention.
Used in Drug Discovery:
2,5-Dihydroxy-N-(2-hydroxyethyl)benzamide is used as a compound of interest in drug discovery, given its unique structure and potential for biological activity, warranting further research to explore its therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 61969-53-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,9,6 and 9 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 61969-53:
(7*6)+(6*1)+(5*9)+(4*6)+(3*9)+(2*5)+(1*3)=157
157 % 10 = 7
So 61969-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO4/c11-4-3-10-9(14)7-5-6(12)1-2-8(7)13/h1-2,5,11-13H,3-4H2,(H,10,14)
