6201-72-5 Usage
Uses
Used in Dye and Pigment Production:
4-[(4-amino-8-hydroxy-1-naphthyl)imino]cyclohexa-2,5-dien-1-one is utilized as a dye and pigment in various industries due to its bright yellow-orange color. Its chemical structure allows for its use in creating vibrant and stable colorants for different applications.
Used in Materials Science:
In the field of materials science, 4-[(4-amino-8-hydroxy-1-naphthyl)imino]cyclohexa-2,5-dien-1-one is used as a component in the development of new materials. Its unique molecular structure contributes to the creation of materials with specific properties, such as color, stability, and reactivity.
Used in Organic Chemistry:
4-[(4-amino-8-hydroxy-1-naphthyl)imino]cyclohexa-2,5-dien-1-one serves as a key intermediate in the synthesis of other organic compounds. Its reactivity and functional groups make it a valuable building block for the development of new organic molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
Due to its unique molecular structure and properties, 4-[(4-amino-8-hydroxy-1-naphthyl)imino]cyclohexa-2,5-dien-1-one may have potential applications in the pharmaceutical industry. It could be used as an active pharmaceutical ingredient or as a key intermediate in the synthesis of drug molecules, contributing to the development of new medications and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 6201-72-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,0 and 1 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6201-72:
(6*6)+(5*2)+(4*0)+(3*1)+(2*7)+(1*2)=65
65 % 10 = 5
So 6201-72-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H12N2O2/c17-13-8-9-14(16-12(13)2-1-3-15(16)20)18-10-4-6-11(19)7-5-10/h1-9,20H,17H2
