62019-34-5 Usage
Uses
Used in Organic Synthesis:
ETHYL 1,2-DIHYDRONAPHTHO[2,1-B]FURAN-2-CARBOXYLATE is used as a key intermediate in the synthesis of various organic compounds. Its unique ring structure and carboxylate ester functionality contribute to the formation of complex molecules in chemical reactions.
Used in Chemical Research:
In the field of chemical research, ETHYL 1,2-DIHYDRONAPHTHO[2,1-B]FURAN-2-CARBOXYLATE serves as a valuable compound for studying its chemical properties and potential applications. Researchers can explore its reactivity, stability, and interactions with other molecules to gain insights into its behavior and possible uses.
Used in Pharmaceutical Industry:
ETHYL 1,2-DIHYDRONAPHTHO[2,1-B]FURAN-2-CARBOXYLATE is used as a building block for the development of new pharmaceutical compounds. Its unique structure and chemical properties may contribute to the creation of novel drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical industry, ETHYL 1,2-DIHYDRONAPHTHO[2,1-B]FURAN-2-CARBOXYLATE is used as a precursor for the synthesis of agrochemicals, such as pesticides and herbicides. Its potential applications in this field may lead to the development of more effective and environmentally friendly products.
Further study and research on ETHYL 1,2-DIHYDRONAPHTHO[2,1-B]FURAN-2-CARBOXYLATE may reveal its potential uses in various other industries, expanding its applications and contributing to the advancement of science and technology.
Check Digit Verification of cas no
The CAS Registry Mumber 62019-34-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,0,1 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 62019-34:
(7*6)+(6*2)+(5*0)+(4*1)+(3*9)+(2*3)+(1*4)=95
95 % 10 = 5
So 62019-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H14O3/c1-2-17-15(16)14-9-12-11-6-4-3-5-10(11)7-8-13(12)18-14/h3-8,14H,2,9H2,1H3/t14-/m1/s1
