62079-29-2 Usage
Molecular Structure
A spirocyclic compound containing a 12-membered carbon ring and an oxygen atom linked in a spiro arrangement.
Usage
Commonly used as a synthetic intermediate in the production of pharmaceuticals and agrochemicals due to its unique structural features.
Fragrance Ingredient
Known for its potential application as a fragrance ingredient in the formulation of perfumes and cosmetics.
Versatile Building Block
Its spirocyclic structure and oxygen atom make it a versatile building block in organic synthesis, allowing for the creation of diverse chemical structures with various functional groups.
Biological Activities
1-Oxaspiro[4.7]dodecane has been studied for its potential biological activities and is of interest in medicinal chemistry research.
Wide-Ranging Applications
This chemical compound has applications in both chemical synthesis and various industrial and consumer products.
Check Digit Verification of cas no
The CAS Registry Mumber 62079-29-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,0,7 and 9 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 62079-29:
(7*6)+(6*2)+(5*0)+(4*7)+(3*9)+(2*2)+(1*9)=122
122 % 10 = 2
So 62079-29-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H20O/c1-2-4-7-11(8-5-3-1)9-6-10-12-11/h1-10H2
62079-29-2Relevant academic research and scientific papers
Oxaspirododecane derivatives and perfume compositions containing them
-
, (2008/06/13)
This invention is directed to oxaspirododecane derivatives, the preparation thereof, and perfume compositions containing same.
