62096-63-3 Usage
Uses
Used in Pharmaceutical Industry:
2-AMINO-4-METHYLAMINO-6-ETHOXY-1,3,5-TRIAZINE is used as an intermediate compound for the synthesis of various pharmaceutical products. Its unique chemical structure allows it to be a versatile building block in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2-AMINO-4-METHYLAMINO-6-ETHOXY-1,3,5-TRIAZINE serves as a key intermediate for the production of a range of chemical compounds. Its reactivity and functional groups make it suitable for further modification and incorporation into more complex molecules, potentially leading to novel materials and applications.
Used in Research and Development:
2-AMINO-4-METHYLAMINO-6-ETHOXY-1,3,5-TRIAZINE is also utilized in research and development settings, where it can be explored for its potential properties and applications. Scientists and researchers may investigate its interactions with other molecules, its stability under various conditions, and its potential use in the creation of new compounds or materials.
Check Digit Verification of cas no
The CAS Registry Mumber 62096-63-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,0,9 and 6 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 62096-63:
(7*6)+(6*2)+(5*0)+(4*9)+(3*6)+(2*6)+(1*3)=123
123 % 10 = 3
So 62096-63-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H11N5O/c1-3-12-6-10-4(7)9-5(8-2)11-6/h3H2,1-2H3,(H3,7,8,9,10,11)
