62108-23-0 Usage
Description
Trimethyldecane, 2,5,6is a volatile organic compound that is typically found in synthetic environments such as carwash effluent tanks and as a byproduct of coal pyrolysis. It is characterized by its chemical structure and properties, which make it suitable for various applications across different industries.
Uses
Used in Industrial Applications:
Trimethyldecane, 2,5,6is used as a component in the production of various industrial products due to its volatile organic nature and compatibility with other substances. Its presence in synthetic environments like carwash effluent tanks and coal pyrolysis processes indicates its potential use in the development of cleaning agents, fuel additives, and other related products.
Used in Environmental Monitoring:
Given its occurrence in synthetic environments, Trimethyldecane, 2,5,6can be used as an indicator for monitoring the presence of volatile organic compounds in environmental samples. This can help in assessing the impact of human activities on the environment and implementing necessary measures to control pollution.
Used in Chemical Research:
Trimethyldecane, 2,5,6can also be utilized in chemical research and development, particularly in the study of volatile organic compounds and their interactions with other substances. This can contribute to the advancement of knowledge in the field of chemistry and the development of new materials and products with improved properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 62108-23-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,1,0 and 8 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 62108-23:
(7*6)+(6*2)+(5*1)+(4*0)+(3*8)+(2*2)+(1*3)=90
90 % 10 = 0
So 62108-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H28/c1-6-7-8-12(4)13(5)10-9-11(2)3/h11-13H,6-10H2,1-5H3
